C16H19N3O2 — CID 134914509
6-benzyl-4-ethoxy-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-one (PubChem CID 134914509) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 6-benzyl-4-ethoxy-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 6-benzyl-4-ethoxy-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 134914509 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 6-benzyl-4-ethoxy-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-one |
| SMILES | CCOc1nc(=O)[nH]c2c1CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C16H19N3O2/c1-2-21-15-13-11-19(10-12-6-4-3-5-7-12)9-8-14(13)17-16(20)18-15/h3-7H,2,8-11H2,1H3,(H,17,18,20) |
| InChIKey | RNDMILKFHSJQMS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |