C20H21ClN2O2S — CID 113097011
N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-4-ethylbenzenesulfonamide (PubChem CID 113097011) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-4-ethylbenzenesulfonamide.
| Compound Name | N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113097011 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NC2CCc3[nH]c4ccc(Cl)cc4c3C2)cc1 |
| InChI | InChI=1S/C20H21ClN2O2S/c1-2-13-3-7-16(8-4-13)26(24,25)23-15-6-10-20-18(12-15)17-11-14(21)5-9-19(17)22-20/h3-5,7-9,11,15,22-23H,2,6,10,12H2,1H3 |
| InChIKey | CTWCIKUKNQFEBX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|