C20H22N2O2S — CID 113096912
4-methyl-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzenesulfonamide (PubChem CID 113096912) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 4-methyl-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113096912 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-methyl-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCc3[nH]c4ccc(C)cc4c3C2)cc1 |
| InChI | InChI=1S/C20H22N2O2S/c1-13-3-7-16(8-4-13)25(23,24)22-15-6-10-20-18(12-15)17-11-14(2)5-9-19(17)21-20/h3-5,7-9,11,15,21-22H,6,10,12H2,1-2H3 |
| InChIKey | SDUJQIYSYPGXJG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|