C20H22N2O4S — CID 113097093
4-methoxy-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzenesulfonamide (PubChem CID 113097093) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 4-methoxy-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzenesulfonamide.
| Compound Name | 4-methoxy-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113097093 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-methoxy-N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCc3[nH]c4ccc(OC)cc4c3C2)cc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-25-14-4-7-16(8-5-14)27(23,24)22-13-3-9-19-17(11-13)18-12-15(26-2)6-10-20(18)21-19/h4-8,10,12-13,21-22H,3,9,11H2,1-2H3 |
| InChIKey | DMDSQNSXDSCFLL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|