C20H22N2O3S — CID 113097106
N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methylbenzenesulfonamide (PubChem CID 113097106) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methylbenzenesulfonamide.
| Compound Name | N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113097106 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(6-methoxy-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methylbenzenesulfonamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC(NS(=O)(=O)c1cccc(C)c1)CC3 |
| InChI | InChI=1S/C20H22N2O3S/c1-13-4-3-5-16(10-13)26(23,24)22-14-6-8-19-17(11-14)18-12-15(25-2)7-9-20(18)21-19/h3-5,7,9-10,12,14,21-22H,6,8,11H2,1-2H3 |
| InChIKey | NTBCPPGLCRYICX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|