C18H24N2O3S — CID 124868439
(2S,3S)-2-methyl-N-[(3R)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]oxolane-3-sulfonamide (PubChem CID 124868439) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is (2S,3S)-2-methyl-N-[(3R)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]oxolane-3-sulfonamide.
| Compound Name | (2S,3S)-2-methyl-N-[(3R)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]oxolane-3-sulfonamide |
|---|---|
| PubChem CID | 124868439 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (2S,3S)-2-methyl-N-[(3R)-6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]oxolane-3-sulfonamide |
| SMILES | Cc1ccc2[nH]c3c(c2c1)C[C@H](NS(=O)(=O)[C@H]1CCO[C@H]1C)CC3 |
| InChI | InChI=1S/C18H24N2O3S/c1-11-3-5-16-14(9-11)15-10-13(4-6-17(15)19-16)20-24(21,22)18-7-8-23-12(18)2/h3,5,9,12-13,18-20H,4,6-8,10H2,1-2H3/t12-,13+,18-/m0/s1 |
| InChIKey | IRIQDWQNWXPFLP-JCGVRSQUSA-N |
| XLogP | 2.43 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|