C19H22N2O2 — CID 110010184
1-(furan-2-yl)-2-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]ethanol (PubChem CID 110010184) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]ethanol.
| Compound Name | 1-(furan-2-yl)-2-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]ethanol |
|---|---|
| PubChem CID | 110010184 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-(furan-2-yl)-2-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]ethanol |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CC(NCC(O)c1ccco1)CC3 |
| InChI | InChI=1S/C19H22N2O2/c1-12-4-6-16-14(9-12)15-10-13(5-7-17(15)21-16)20-11-18(22)19-3-2-8-23-19/h2-4,6,8-9,13,18,20-22H,5,7,10-11H2,1H3 |
| InChIKey | KAAFYKSCMBIFLC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|