C20H24N2O2 — CID 110010893
2-(furan-2-yl)-1-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]propan-2-ol (PubChem CID 110010893) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]propan-2-ol.
| Compound Name | 2-(furan-2-yl)-1-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 110010893 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-(furan-2-yl)-1-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]propan-2-ol |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CC(NCC(C)(O)c1ccco1)CC3 |
| InChI | InChI=1S/C20H24N2O2/c1-13-5-7-17-15(10-13)16-11-14(6-8-18(16)22-17)21-12-20(2,23)19-4-3-9-24-19/h3-5,7,9-10,14,21-23H,6,8,11-12H2,1-2H3 |
| InChIKey | VSIWEWYXHAHDSP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|