C20H22N2O3 — CID 111482489
N-[2-(furan-2-yl)-2-hydroxypropyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 111482489) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxypropyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 111482489 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | CC(O)(CNC(=O)c1ccc2[nH]c3c(c2c1)CCCC3)c1ccco1 |
| InChI | InChI=1S/C20H22N2O3/c1-20(24,18-7-4-10-25-18)12-21-19(23)13-8-9-17-15(11-13)14-5-2-3-6-16(14)22-17/h4,7-11,22,24H,2-3,5-6,12H2,1H3,(H,21,23) |
| InChIKey | HERDKMQVUNGBGF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|