C15H14N2O4S — CID 102559272
N-[2-(furan-2-yl)-2-hydroxypropyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide (PubChem CID 102559272) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxypropyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 102559272 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
| SMILES | CC(O)(CNC(=O)c1ccc2[nH]c(=S)oc2c1)c1ccco1 |
| InChI | InChI=1S/C15H14N2O4S/c1-15(19,12-3-2-6-20-12)8-16-13(18)9-4-5-10-11(7-9)21-14(22)17-10/h2-7,19H,8H2,1H3,(H,16,18)(H,17,22) |
| InChIKey | SFAUTDASTUVOMX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|