C17H24N2O — CID 110005257
2-methyl-1-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]propan-2-ol (PubChem CID 110005257) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-methyl-1-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]propan-2-ol.
| Compound Name | 2-methyl-1-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 110005257 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-methyl-1-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl)amino]propan-2-ol |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CC(NCC(C)(C)O)CC3 |
| InChI | InChI=1S/C17H24N2O/c1-11-4-6-15-13(8-11)14-9-12(5-7-16(14)19-15)18-10-17(2,3)20/h4,6,8,12,18-20H,5,7,9-10H2,1-3H3 |
| InChIKey | JSVDFBMTXRCDLM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|