C13H16N2O2S — CID 113096584
N-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanesulfonamide (PubChem CID 113096584) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is N-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanesulfonamide.
| Compound Name | N-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 113096584 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C13H16N2O2S/c1-18(16,17)15-9-6-7-13-11(8-9)10-4-2-3-5-12(10)14-13/h2-5,9,14-15H,6-8H2,1H3 |
| InChIKey | IGYVFOFNQMHWCS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|