C20H23ClN2 — CID 154734790
(3R)-N-[(1S)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine;hydrochloride (PubChem CID 154734790) has the molecular formula C20H23ClN2 and a molecular weight of 326.87 g/mol. Its IUPAC name is (3R)-N-[(1S)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine;hydrochloride.
| Compound Name | (3R)-N-[(1S)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine;hydrochloride |
|---|---|
| PubChem CID | 154734790 |
| Molecular Formula | C20H23ClN2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (3R)-N-[(1S)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine;hydrochloride |
| SMILES | C[C@H](N[C@@H]1CCc2[nH]c3ccccc3c2C1)c1ccccc1.Cl |
| InChI | InChI=1S/C20H22N2.ClH/c1-14(15-7-3-2-4-8-15)21-16-11-12-20-18(13-16)17-9-5-6-10-19(17)22-20;/h2-10,14,16,21-22H,11-13H2,1H3;1H/t14-,16+;/m0./s1 |
| InChIKey | XVGZHMROJJHGGF-KUARMEPBSA-N |
| XLogP | 4.80 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|