C23H24ClN3O2 — CID 57257831
3-[(2-chloroacetyl)amino]-3-phenyl-N-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)propanamide (PubChem CID 57257831) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 3-[(2-chloroacetyl)amino]-3-phenyl-N-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)propanamide.
| Compound Name | 3-[(2-chloroacetyl)amino]-3-phenyl-N-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)propanamide |
|---|---|
| PubChem CID | 57257831 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-[(2-chloroacetyl)amino]-3-phenyl-N-(2,3,4,9-tetrahydro-1H-carbazol-3-yl)propanamide |
| SMILES | O=C(CC(NC(=O)CCl)c1ccccc1)NC1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C23H24ClN3O2/c24-14-23(29)27-21(15-6-2-1-3-7-15)13-22(28)25-16-10-11-20-18(12-16)17-8-4-5-9-19(17)26-20/h1-9,16,21,26H,10-14H2,(H,25,28)(H,27,29) |
| InChIKey | ZJFIZNQHAOJSLI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|