C20H22N4O2 — CID 67618667
3-N-[(1S)-1-(4-nitrophenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazole-3,6-diamine (PubChem CID 67618667) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-N-[(1S)-1-(4-nitrophenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazole-3,6-diamine.
| Compound Name | 3-N-[(1S)-1-(4-nitrophenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazole-3,6-diamine |
|---|---|
| PubChem CID | 67618667 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 3-N-[(1S)-1-(4-nitrophenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazole-3,6-diamine |
| SMILES | C[C@H](NC1CCc2[nH]c3ccc(N)cc3c2C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-12(13-2-6-16(7-3-13)24(25)26)22-15-5-9-20-18(11-15)17-10-14(21)4-8-19(17)23-20/h2-4,6-8,10,12,15,22-23H,5,9,11,21H2,1H3/t12-,15?/m0/s1 |
| InChIKey | GCJBIIVAJPWMMU-SFVWDYPZSA-N |
| XLogP | 3.87 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|