C20H20BrN3O2 — CID 54353659
(3R)-6-bromo-N-[(1R)-1-(4-nitrophenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 54353659) has the molecular formula C20H20BrN3O2 and a molecular weight of 414.30 g/mol. Its IUPAC name is (3R)-6-bromo-N-[(1R)-1-(4-nitrophenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | (3R)-6-bromo-N-[(1R)-1-(4-nitrophenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 54353659 |
| Molecular Formula | C20H20BrN3O2 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | (3R)-6-bromo-N-[(1R)-1-(4-nitrophenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | C[C@@H](N[C@@H]1CCc2[nH]c3ccc(Br)cc3c2C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20BrN3O2/c1-12(13-2-6-16(7-3-13)24(25)26)22-15-5-9-20-18(11-15)17-10-14(21)4-8-19(17)23-20/h2-4,6-8,10,12,15,22-23H,5,9,11H2,1H3/t12-,15-/m1/s1 |
| InChIKey | UHOPUYGYPYGVQM-IUODEOHRSA-N |
| XLogP | 5.05 |
| TPSA | 70.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|