C21H21BrN2O3 — CID 92768204
N-[(3S)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-3,5-dimethoxybenzamide (PubChem CID 92768204) has the molecular formula C21H21BrN2O3 and a molecular weight of 429.31 g/mol. Its IUPAC name is N-[(3S)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(3S)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 92768204 |
| Molecular Formula | C21H21BrN2O3 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | N-[(3S)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N[C@H]2CCc3[nH]c4ccc(Br)cc4c3C2)c1 |
| InChI | InChI=1S/C21H21BrN2O3/c1-26-15-7-12(8-16(11-15)27-2)21(25)23-14-4-6-20-18(10-14)17-9-13(22)3-5-19(17)24-20/h3,5,7-9,11,14,24H,4,6,10H2,1-2H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | NHAPZZFRHPEIRU-AWEZNQCLSA-N |
| XLogP | 4.23 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|