C17H18BrF3N2O — CID 92758575
(2R)-N-[(3S)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-4,4,4-trifluoro-2-methylbutanamide (PubChem CID 92758575) has the molecular formula C17H18BrF3N2O and a molecular weight of 403.24 g/mol. Its IUPAC name is (2R)-N-[(3S)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-4,4,4-trifluoro-2-methylbutanamide.
| Compound Name | (2R)-N-[(3S)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-4,4,4-trifluoro-2-methylbutanamide |
|---|---|
| PubChem CID | 92758575 |
| Molecular Formula | C17H18BrF3N2O |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | (2R)-N-[(3S)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-4,4,4-trifluoro-2-methylbutanamide |
| SMILES | C[C@H](CC(F)(F)F)C(=O)N[C@H]1CCc2[nH]c3ccc(Br)cc3c2C1 |
| InChI | InChI=1S/C17H18BrF3N2O/c1-9(8-17(19,20)21)16(24)22-11-3-5-15-13(7-11)12-6-10(18)2-4-14(12)23-15/h2,4,6,9,11,23H,3,5,7-8H2,1H3,(H,22,24)/t9-,11+/m1/s1 |
| InChIKey | DYIJSSNDNWLCKX-KOLCDFICSA-N |
| XLogP | 4.49 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|