C20H25BrN2O — CID 92758417
N-[(3R)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-4-methylcyclohexane-1-carboxamide (PubChem CID 92758417) has the molecular formula C20H25BrN2O and a molecular weight of 389.34 g/mol. Its IUPAC name is N-[(3R)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-4-methylcyclohexane-1-carboxamide.
| Compound Name | N-[(3R)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 92758417 |
| Molecular Formula | C20H25BrN2O |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[(3R)-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl]-4-methylcyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(=O)N[C@@H]2CCc3[nH]c4ccc(Br)cc4c3C2)CC1 |
| InChI | InChI=1S/C20H25BrN2O/c1-12-2-4-13(5-3-12)20(24)22-15-7-9-19-17(11-15)16-10-14(21)6-8-18(16)23-19/h6,8,10,12-13,15,23H,2-5,7,9,11H2,1H3,(H,22,24)/t12?,13?,15-/m1/s1 |
| InChIKey | BPELQZQQWMKPLI-SSDMNJCBSA-N |
| XLogP | 4.73 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|