C16H20N2O — CID 18971903
1-[6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]propan-1-one (PubChem CID 18971903) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-[6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]propan-1-one.
| Compound Name | 1-[6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 18971903 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-[6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]propan-1-one |
| SMILES | CCC(=O)c1ccc2[nH]c3c(c2c1)CC(NC)CC3 |
| InChI | InChI=1S/C16H20N2O/c1-3-16(19)10-4-6-14-12(8-10)13-9-11(17-2)5-7-15(13)18-14/h4,6,8,11,17-18H,3,5,7,9H2,1-2H3 |
| InChIKey | BASVZDYNVWIHTF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|