C20H21BrN2O — CID 46098178
N-(6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-methylcyclohexa-2,5-diene-1-carboxamide (PubChem CID 46098178) has the molecular formula C20H21BrN2O and a molecular weight of 385.31 g/mol. Its IUPAC name is N-(6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-methylcyclohexa-2,5-diene-1-carboxamide.
| Compound Name | N-(6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-methylcyclohexa-2,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 46098178 |
| Molecular Formula | C20H21BrN2O |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-(6-bromo-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-methylcyclohexa-2,5-diene-1-carboxamide |
| SMILES | CC1=CCC=CC1C(=O)NC1CCc2[nH]c3ccc(Br)cc3c2C1 |
| InChI | InChI=1S/C20H21BrN2O/c1-12-4-2-3-5-15(12)20(24)22-14-7-9-19-17(11-14)16-10-13(21)6-8-18(16)23-19/h3-6,8,10,14-15,23H,2,7,9,11H2,1H3,(H,22,24) |
| InChIKey | MZEPIKKBFBBBLA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|