C29H28N6O8 — CID 86346010
(2S)-2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid;(6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 86346010) has the molecular formula C29H28N6O8 and a molecular weight of 588.58 g/mol. Its IUPAC name is (2S)-2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid;(6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | (2S)-2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid;(6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 86346010 |
| Molecular Formula | C29H28N6O8 |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | (2S)-2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid;(6R)-6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | CN[C@@H]1CCc2[nH]c3ccc(C(N)=O)cc3c2C1.O=C(N[C@H](C(=O)O)c1ccccc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11N3O7.C14H17N3O/c19-14(16-13(15(20)21)9-4-2-1-3-5-9)10-6-11(17(22)23)8-12(7-10)18(24)25;1-16-9-3-5-13-11(7-9)10-6-8(14(15)18)2-4-12(10)17-13/h1-8,13H,(H,16,19)(H,20,21);2,4,6,9,16-17H,3,5,7H2,1H3,(H2,15,18)/t13-;9-/m01/s1 |
| InChIKey | CENMAMKCEUZGKZ-AEHPOSSRSA-N |
| XLogP | 3.40 |
| TPSA | 223.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|