C14H17N3O — CID 171382229
6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-4-carboxamide (PubChem CID 171382229) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-4-carboxamide.
| Compound Name | 6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-4-carboxamide |
|---|---|
| PubChem CID | 171382229 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 6-(methylamino)-6,7,8,9-tetrahydro-5H-carbazole-4-carboxamide |
| SMILES | CNC1CCc2[nH]c3cccc(C(N)=O)c3c2C1 |
| InChI | InChI=1S/C14H17N3O/c1-16-8-5-6-11-10(7-8)13-9(14(15)18)3-2-4-12(13)17-11/h2-4,8,16-17H,5-7H2,1H3,(H2,15,18) |
| InChIKey | HQQZYGMUCRYWSS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |