C19H26N2O2 — CID 97308735
methyl (2R)-2-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]hexanoate (PubChem CID 97308735) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is methyl (2R)-2-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]hexanoate.
| Compound Name | methyl (2R)-2-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]hexanoate |
|---|---|
| PubChem CID | 97308735 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | methyl (2R)-2-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]hexanoate |
| SMILES | CCCC[C@@H](N[C@@H]1CCc2[nH]c3ccccc3c2C1)C(=O)OC |
| InChI | InChI=1S/C19H26N2O2/c1-3-4-8-18(19(22)23-2)20-13-10-11-17-15(12-13)14-7-5-6-9-16(14)21-17/h5-7,9,13,18,20-21H,3-4,8,10-12H2,1-2H3/t13-,18-/m1/s1 |
| InChIKey | WRDQIYSTYAHSNH-FZKQIMNGSA-N |
| XLogP | 3.35 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|