C15H19N — CID 65335334
3-propyl-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 65335334) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-propyl-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 3-propyl-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 65335334 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3-propyl-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | CCCC1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C15H19N/c1-2-5-11-8-9-15-13(10-11)12-6-3-4-7-14(12)16-15/h3-4,6-7,11,16H,2,5,8-10H2,1H3 |
| InChIKey | BGUQVEJYOAPJRW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|