C15H16F3N — CID 79193595
5,6,7-trifluoro-3-propyl-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 79193595) has the molecular formula C15H16F3N and a molecular weight of 267.29 g/mol. Its IUPAC name is 5,6,7-trifluoro-3-propyl-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 5,6,7-trifluoro-3-propyl-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 79193595 |
| Molecular Formula | C15H16F3N |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 5,6,7-trifluoro-3-propyl-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | CCCC1CCc2[nH]c3cc(F)c(F)c(F)c3c2C1 |
| InChI | InChI=1S/C15H16F3N/c1-2-3-8-4-5-11-9(6-8)13-12(19-11)7-10(16)14(17)15(13)18/h7-8,19H,2-6H2,1H3 |
| InChIKey | POLVEZXNRHEXMC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|