C14H18N2 — CID 82275010
6-ethyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 82275010) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 6-ethyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | 6-ethyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 82275010 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 6-ethyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | CCc1ccc2[nH]c3c(c2c1)CC(N)CC3 |
| InChI | InChI=1S/C14H18N2/c1-2-9-3-5-13-11(7-9)12-8-10(15)4-6-14(12)16-13/h3,5,7,10,16H,2,4,6,8,15H2,1H3 |
| InChIKey | YLFREWHQQVJBOR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|