C12H17N — CID 130940477
(2R)-7-ethyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 130940477) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (2R)-7-ethyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2R)-7-ethyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 130940477 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (2R)-7-ethyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCc1ccc2c(c1)C[C@H](N)CC2 |
| InChI | InChI=1S/C12H17N/c1-2-9-3-4-10-5-6-12(13)8-11(10)7-9/h3-4,7,12H,2,5-6,8,13H2,1H3/t12-/m1/s1 |
| InChIKey | QGFDMVBHLWZQKD-GFCCVEGCSA-N |
| XLogP | 2.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |