C18H26N2 — CID 73057285
(3S)-N,N-di(propan-2-yl)-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 73057285) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (3S)-N,N-di(propan-2-yl)-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | (3S)-N,N-di(propan-2-yl)-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 73057285 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (3S)-N,N-di(propan-2-yl)-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | CC(C)N(C(C)C)[C@H]1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C18H26N2/c1-12(2)20(13(3)4)14-9-10-18-16(11-14)15-7-5-6-8-17(15)19-18/h5-8,12-14,19H,9-11H2,1-4H3/t14-/m0/s1 |
| InChIKey | NQCREMCGJYWJKR-AWEZNQCLSA-N |
| XLogP | 4.14 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|