C16H22N2 — CID 177206921
3-methyl-4-propyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole (PubChem CID 177206921) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 3-methyl-4-propyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole.
| Compound Name | 3-methyl-4-propyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole |
|---|---|
| PubChem CID | 177206921 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 3-methyl-4-propyl-2,4,5,6-tetrahydro-1H-azepino[4,5-b]indole |
| SMILES | CCCC1Cc2[nH]c3ccccc3c2CCN1C |
| InChI | InChI=1S/C16H22N2/c1-3-6-12-11-16-14(9-10-18(12)2)13-7-4-5-8-15(13)17-16/h4-5,7-8,12,17H,3,6,9-11H2,1-2H3 |
| InChIKey | GOIOTEMHIHATCW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|