C19H26N2 — CID 163002483
16-ethyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraene (PubChem CID 163002483) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 16-ethyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraene.
| Compound Name | 16-ethyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraene |
|---|---|
| PubChem CID | 163002483 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 16-ethyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraene |
| SMILES | CCC1CCN2CCc3c([nH]c4ccccc34)CCC1C2 |
| InChI | InChI=1S/C19H26N2/c1-2-14-9-11-21-12-10-17-16-5-3-4-6-18(16)20-19(17)8-7-15(14)13-21/h3-6,14-15,20H,2,7-13H2,1H3 |
| InChIKey | NILVXHVRQIFNHC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|