C11H13N3 — CID 118402613
1,3,4,9-tetrahydropyrido[3,4-b]indol-2-amine (PubChem CID 118402613) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 1,3,4,9-tetrahydropyrido[3,4-b]indol-2-amine.
| Compound Name | 1,3,4,9-tetrahydropyrido[3,4-b]indol-2-amine |
|---|---|
| PubChem CID | 118402613 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1,3,4,9-tetrahydropyrido[3,4-b]indol-2-amine |
| SMILES | NN1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C11H13N3/c12-14-6-5-9-8-3-1-2-4-10(8)13-11(9)7-14/h1-4,13H,5-7,12H2 |
| InChIKey | SCNDKDGKOVNHHV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|