C14H18N2O3S — CID 87851999
1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propane-1-sulfonic acid (PubChem CID 87851999) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propane-1-sulfonic acid.
| Compound Name | 1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87851999 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propane-1-sulfonic acid |
| SMILES | CCC(N1CCc2c([nH]c3ccccc23)C1)S(=O)(=O)O |
| InChI | InChI=1S/C14H18N2O3S/c1-2-14(20(17,18)19)16-8-7-11-10-5-3-4-6-12(10)15-13(11)9-16/h3-6,14-15H,2,7-9H2,1H3,(H,17,18,19) |
| InChIKey | IITCWNKTHHIUGX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|