C13H18N2 — CID 143420706
2-methyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole;molecular hydrogen (PubChem CID 143420706) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-methyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole;molecular hydrogen.
| Compound Name | 2-methyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole;molecular hydrogen |
|---|---|
| PubChem CID | 143420706 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-methyl-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole;molecular hydrogen |
| SMILES | CN1CCCc2c([nH]c3ccccc23)C1.[H][H] |
| InChI | InChI=1S/C13H16N2.H2/c1-15-8-4-6-11-10-5-2-3-7-12(10)14-13(11)9-15;/h2-3,5,7,14H,4,6,8-9H2,1H3;1H |
| InChIKey | QIVVUNCPBQHCMS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|