C18H25N3O — CID 56729983
1-methyl-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylmethyl)piperidin-3-ol (PubChem CID 56729983) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-methyl-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylmethyl)piperidin-3-ol.
| Compound Name | 1-methyl-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 56729983 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-methyl-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylmethyl)piperidin-3-ol |
| SMILES | CN1CCCC(O)(CN2CCc3[nH]c4ccccc4c3C2)C1 |
| InChI | InChI=1S/C18H25N3O/c1-20-9-4-8-18(22,12-20)13-21-10-7-17-15(11-21)14-5-2-3-6-16(14)19-17/h2-3,5-6,19,22H,4,7-13H2,1H3 |
| InChIKey | LNEZLZQNIHGLNV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|