C13H19N2P — CID 91258224
ethane;1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylphosphane (PubChem CID 91258224) has the molecular formula C13H19N2P and a molecular weight of 234.28 g/mol. Its IUPAC name is ethane;1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylphosphane.
| Compound Name | ethane;1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylphosphane |
|---|---|
| PubChem CID | 91258224 |
| Molecular Formula | C13H19N2P |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | ethane;1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylphosphane |
| SMILES | CC.PN1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C11H13N2P.C2H6/c14-13-6-5-11-9(7-13)8-3-1-2-4-10(8)12-11;1-2/h1-4,12H,5-7,14H2;1-2H3 |
| InChIKey | VLODMGQDLNUYNX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|