C20H21N3O2 — CID 23113593
N-(4-methoxyphenyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide (PubChem CID 23113593) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 23113593 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-(4-methoxyphenyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCCc3c([nH]c4ccccc34)C2)cc1 |
| InChI | InChI=1S/C20H21N3O2/c1-25-15-10-8-14(9-11-15)21-20(24)23-12-4-6-17-16-5-2-3-7-18(16)22-19(17)13-23/h2-3,5,7-11,22H,4,6,12-13H2,1H3,(H,21,24) |
| InChIKey | BAAAPADTHBAMGC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|