C27H26N4O2 — CID 19006871
N-naphthalen-2-yl-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidine-1-carboxamide (PubChem CID 19006871) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-naphthalen-2-yl-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidine-1-carboxamide.
| Compound Name | N-naphthalen-2-yl-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 19006871 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-naphthalen-2-yl-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(C1CCCN1C(=O)Nc1ccc2ccccc2c1)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C27H26N4O2/c32-26(30-15-13-22-21-8-3-4-9-23(21)29-24(22)17-30)25-10-5-14-31(25)27(33)28-20-12-11-18-6-1-2-7-19(18)16-20/h1-4,6-9,11-12,16,25,29H,5,10,13-15,17H2,(H,28,33) |
| InChIKey | SNGVDTHAYBUBBZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|