C30H29Cl2N5O7 — CID 67755050
(3R,4R)-1-[(2S)-1-[(3R)-2-[(3,4-dichlorophenyl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]pyrrolidine-2-carbonyl]pyrrolidine-3,4-dicarboxylic acid (PubChem CID 67755050) has the molecular formula C30H29Cl2N5O7 and a molecular weight of 642.50 g/mol. Its IUPAC name is (3R,4R)-1-[(2S)-1-[(3R)-2-[(3,4-dichlorophenyl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]pyrrolidine-2-carbonyl]pyrrolidine-3,4-dicarboxylic acid.
| Compound Name | (3R,4R)-1-[(2S)-1-[(3R)-2-[(3,4-dichlorophenyl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]pyrrolidine-2-carbonyl]pyrrolidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 67755050 |
| Molecular Formula | C30H29Cl2N5O7 |
| Molecular Weight | 642.50 g/mol |
| Exact Mass | 641.14 |
| IUPAC Name | (3R,4R)-1-[(2S)-1-[(3R)-2-[(3,4-dichlorophenyl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]pyrrolidine-2-carbonyl]pyrrolidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1CN(C(=O)[C@@H]2CCCN2C(=O)[C@H]2Cc3c([nH]c4ccccc34)CN2C(=O)Nc2ccc(Cl)c(Cl)c2)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C30H29Cl2N5O7/c31-20-8-7-15(10-21(20)32)33-30(44)37-14-23-17(16-4-1-2-5-22(16)34-23)11-25(37)27(39)36-9-3-6-24(36)26(38)35-12-18(28(40)41)19(13-35)29(42)43/h1-2,4-5,7-8,10,18-19,24-25,34H,3,6,9,11-14H2,(H,33,44)(H,40,41)(H,42,43)/t18-,19-,24-,25+/m0/s1 |
| InChIKey | AEISSHUAZJAXIH-QXVOXHNYSA-N |
| XLogP | 3.67 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|