C30H34Cl2N6O6 — CID 67754810
(4S)-5-amino-4-[[(2S)-2-[[(3R)-2-[(3,4-dichlorophenyl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid (PubChem CID 67754810) has the molecular formula C30H34Cl2N6O6 and a molecular weight of 645.54 g/mol. Its IUPAC name is (4S)-5-amino-4-[[(2S)-2-[[(3R)-2-[(3,4-dichlorophenyl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-amino-4-[[(2S)-2-[[(3R)-2-[(3,4-dichlorophenyl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67754810 |
| Molecular Formula | C30H34Cl2N6O6 |
| Molecular Weight | 645.54 g/mol |
| Exact Mass | 644.19 |
| IUPAC Name | (4S)-5-amino-4-[[(2S)-2-[[(3R)-2-[(3,4-dichlorophenyl)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H]1Cc2c([nH]c3ccccc23)CN1C(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)N[C@@H](CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C30H34Cl2N6O6/c1-15(2)11-23(28(42)36-22(27(33)41)9-10-26(39)40)37-29(43)25-13-18-17-5-3-4-6-21(17)35-24(18)14-38(25)30(44)34-16-7-8-19(31)20(32)12-16/h3-8,12,15,22-23,25,35H,9-11,13-14H2,1-2H3,(H2,33,41)(H,34,44)(H,36,42)(H,37,43)(H,39,40)/t22-,23-,25+/m0/s1 |
| InChIKey | YKZYMXZFNISCKI-SONWIMMPSA-N |
| XLogP | 3.80 |
| TPSA | 186.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|