C21H22Cl2N4O — CID 44533104
N-(3,4-dichlorophenyl)-1-[(dimethylamino)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 44533104) has the molecular formula C21H22Cl2N4O and a molecular weight of 417.34 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-[(dimethylamino)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-1-[(dimethylamino)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 44533104 |
| Molecular Formula | C21H22Cl2N4O |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-[(dimethylamino)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | CN(C)CC1c2[nH]c3ccccc3c2CCN1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H22Cl2N4O/c1-26(2)12-19-20-15(14-5-3-4-6-18(14)25-20)9-10-27(19)21(28)24-13-7-8-16(22)17(23)11-13/h3-8,11,19,25H,9-10,12H2,1-2H3,(H,24,28) |
| InChIKey | SRAWRVSXENWJTF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|