C23H25Br2N3O — CID 3787826
N-(2,6-dibromo-4-propan-2-ylphenyl)-1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 3787826) has the molecular formula C23H25Br2N3O and a molecular weight of 519.28 g/mol. Its IUPAC name is N-(2,6-dibromo-4-propan-2-ylphenyl)-1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-(2,6-dibromo-4-propan-2-ylphenyl)-1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 3787826 |
| Molecular Formula | C23H25Br2N3O |
| Molecular Weight | 519.28 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | N-(2,6-dibromo-4-propan-2-ylphenyl)-1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | CCC1c2[nH]c3ccccc3c2CCN1C(=O)Nc1c(Br)cc(C(C)C)cc1Br |
| InChI | InChI=1S/C23H25Br2N3O/c1-4-20-21-16(15-7-5-6-8-19(15)26-21)9-10-28(20)23(29)27-22-17(24)11-14(13(2)3)12-18(22)25/h5-8,11-13,20,26H,4,9-10H2,1-3H3,(H,27,29) |
| InChIKey | KADPDWGOUUISEL-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.28 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|