C20H22N4S — CID 23877395
1-ethyl-N-(pyridin-3-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide (PubChem CID 23877395) has the molecular formula C20H22N4S and a molecular weight of 350.49 g/mol. Its IUPAC name is 1-ethyl-N-(pyridin-3-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide.
| Compound Name | 1-ethyl-N-(pyridin-3-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide |
|---|---|
| PubChem CID | 23877395 |
| Molecular Formula | C20H22N4S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-ethyl-N-(pyridin-3-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide |
| SMILES | CCC1c2[nH]c3ccccc3c2CCN1C(=S)NCc1cccnc1 |
| InChI | InChI=1S/C20H22N4S/c1-2-18-19-16(15-7-3-4-8-17(15)23-19)9-11-24(18)20(25)22-13-14-6-5-10-21-12-14/h3-8,10,12,18,23H,2,9,11,13H2,1H3,(H,22,25) |
| InChIKey | BYFABLRSAAAXAC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|