C20H19BrFN3S — CID 3754157
N-(2-bromo-4-fluorophenyl)-1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide (PubChem CID 3754157) has the molecular formula C20H19BrFN3S and a molecular weight of 432.36 g/mol. Its IUPAC name is N-(2-bromo-4-fluorophenyl)-1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide.
| Compound Name | N-(2-bromo-4-fluorophenyl)-1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide |
|---|---|
| PubChem CID | 3754157 |
| Molecular Formula | C20H19BrFN3S |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | N-(2-bromo-4-fluorophenyl)-1-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide |
| SMILES | CCC1c2[nH]c3ccccc3c2CCN1C(=S)Nc1ccc(F)cc1Br |
| InChI | InChI=1S/C20H19BrFN3S/c1-2-18-19-14(13-5-3-4-6-16(13)23-19)9-10-25(18)20(26)24-17-8-7-12(22)11-15(17)21/h3-8,11,18,23H,2,9-10H2,1H3,(H,24,26) |
| InChIKey | DWVLKACBRNQIGE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|