C24H23FN2 — CID 71567707
(1R)-1-ethyl-6-fluoro-2-(naphthalen-1-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 71567707) has the molecular formula C24H23FN2 and a molecular weight of 358.46 g/mol. Its IUPAC name is (1R)-1-ethyl-6-fluoro-2-(naphthalen-1-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R)-1-ethyl-6-fluoro-2-(naphthalen-1-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 71567707 |
| Molecular Formula | C24H23FN2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1R)-1-ethyl-6-fluoro-2-(naphthalen-1-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC[C@@H]1c2[nH]c3ccc(F)cc3c2CCN1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C24H23FN2/c1-2-23-24-20(21-14-18(25)10-11-22(21)26-24)12-13-27(23)15-17-8-5-7-16-6-3-4-9-19(16)17/h3-11,14,23,26H,2,12-13,15H2,1H3/t23-/m1/s1 |
| InChIKey | UUJJZCZPXVUGQF-HSZRJFAPSA-N |
| XLogP | 5.97 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|