C26H22N4O — CID 25278325
3-[(1S)-2-(quinoxalin-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol (PubChem CID 25278325) has the molecular formula C26H22N4O and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-[(1S)-2-(quinoxalin-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol.
| Compound Name | 3-[(1S)-2-(quinoxalin-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol |
|---|---|
| PubChem CID | 25278325 |
| Molecular Formula | C26H22N4O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 3-[(1S)-2-(quinoxalin-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenol |
| SMILES | Oc1cccc([C@H]2c3[nH]c4ccccc4c3CCN2Cc2cccc3nccnc23)c1 |
| InChI | InChI=1S/C26H22N4O/c31-19-7-3-5-17(15-19)26-25-21(20-8-1-2-9-22(20)29-25)11-14-30(26)16-18-6-4-10-23-24(18)28-13-12-27-23/h1-10,12-13,15,26,29,31H,11,14,16H2/t26-/m0/s1 |
| InChIKey | HVHZMWPNICPLRG-SANMLTNESA-N |
| XLogP | 4.96 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|