C21H19ClN4 — CID 45252014
1-(3-chlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 45252014) has the molecular formula C21H19ClN4 and a molecular weight of 362.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(3-chlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 45252014 |
| Molecular Formula | C21H19ClN4 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Clc1cccc(C2c3[nH]c4ccccc4c3CCN2Cc2ncc[nH]2)c1 |
| InChI | InChI=1S/C21H19ClN4/c22-15-5-3-4-14(12-15)21-20-17(16-6-1-2-7-18(16)25-20)8-11-26(21)13-19-23-9-10-24-19/h1-7,9-10,12,21,25H,8,11,13H2,(H,23,24) |
| InChIKey | HUGSZSMOTITATO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|