C25H19ClN2O2 — CID 45168771
1-[1-(3-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylethane-1,2-dione (PubChem CID 45168771) has the molecular formula C25H19ClN2O2 and a molecular weight of 414.89 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[1-(3-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 45168771 |
| Molecular Formula | C25H19ClN2O2 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 1-[1-(3-chlorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCc2c([nH]c3ccccc23)C1c1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C25H19ClN2O2/c26-18-10-6-9-17(15-18)23-22-20(19-11-4-5-12-21(19)27-22)13-14-28(23)25(30)24(29)16-7-2-1-3-8-16/h1-12,15,23,27H,13-14H2 |
| InChIKey | ALACVSBEXUHBHN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|