C22H22N4O — CID 25287071
(1S)-2-(1H-imidazol-2-ylmethyl)-1-(3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 25287071) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is (1S)-2-(1H-imidazol-2-ylmethyl)-1-(3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-2-(1H-imidazol-2-ylmethyl)-1-(3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 25287071 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1S)-2-(1H-imidazol-2-ylmethyl)-1-(3-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1cccc([C@H]2c3[nH]c4ccccc4c3CCN2Cc2ncc[nH]2)c1 |
| InChI | InChI=1S/C22H22N4O/c1-27-16-6-4-5-15(13-16)22-21-18(17-7-2-3-8-19(17)25-21)9-12-26(22)14-20-23-10-11-24-20/h2-8,10-11,13,22,25H,9,12,14H2,1H3,(H,23,24)/t22-/m0/s1 |
| InChIKey | KFERLRBBOBFRAN-QFIPXVFZSA-N |
| XLogP | 4.05 |
| TPSA | 56.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|