C26H27N3O3 — CID 95802713
[2-methoxy-5-[[(1S)-6-methoxy-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenyl]methanol (PubChem CID 95802713) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is [2-methoxy-5-[[(1S)-6-methoxy-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenyl]methanol.
| Compound Name | [2-methoxy-5-[[(1S)-6-methoxy-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 95802713 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | [2-methoxy-5-[[(1S)-6-methoxy-1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenyl]methanol |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(Cc1ccc(OC)c(CO)c1)[C@H]3c1cccnc1 |
| InChI | InChI=1S/C26H27N3O3/c1-31-20-6-7-23-22(13-20)21-9-11-29(15-17-5-8-24(32-2)19(12-17)16-30)26(25(21)28-23)18-4-3-10-27-14-18/h3-8,10,12-14,26,28,30H,9,11,15-16H2,1-2H3/t26-/m0/s1 |
| InChIKey | WYGUBJIOLMQQLJ-SANMLTNESA-N |
| XLogP | 4.22 |
| TPSA | 70.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|